C17H15ClN4O3S — CID 23745625
3-amino-N-(2-chloro-5-nitrophenyl)-6-propan-2-ylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 23745625) has the molecular formula C17H15ClN4O3S and a molecular weight of 390.85 g/mol. Its IUPAC name is 3-amino-N-(2-chloro-5-nitrophenyl)-6-propan-2-ylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-(2-chloro-5-nitrophenyl)-6-propan-2-ylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 23745625 |
| Molecular Formula | C17H15ClN4O3S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 3-amino-N-(2-chloro-5-nitrophenyl)-6-propan-2-ylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CC(C)c1ccc2c(N)c(C(=O)Nc3cc([N+](=O)[O-])ccc3Cl)sc2n1 |
| InChI | InChI=1S/C17H15ClN4O3S/c1-8(2)12-6-4-10-14(19)15(26-17(10)21-12)16(23)20-13-7-9(22(24)25)3-5-11(13)18/h3-8H,19H2,1-2H3,(H,20,23) |
| InChIKey | YETFECUEVQPZSG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|