C23H25ClN4O3S — CID 23916988
3-amino-N-(2-chloro-5-nitrophenyl)-6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide (PubChem CID 23916988) has the molecular formula C23H25ClN4O3S and a molecular weight of 473.00 g/mol. Its IUPAC name is 3-amino-N-(2-chloro-5-nitrophenyl)-6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | 3-amino-N-(2-chloro-5-nitrophenyl)-6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 23916988 |
| Molecular Formula | C23H25ClN4O3S |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 3-amino-N-(2-chloro-5-nitrophenyl)-6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| SMILES | CCC(C)(C)C1CCc2nc3sc(C(=O)Nc4cc([N+](=O)[O-])ccc4Cl)c(N)c3cc2C1 |
| InChI | InChI=1S/C23H25ClN4O3S/c1-4-23(2,3)13-5-8-17-12(9-13)10-15-19(25)20(32-22(15)27-17)21(29)26-18-11-14(28(30)31)6-7-16(18)24/h6-7,10-11,13H,4-5,8-9,25H2,1-3H3,(H,26,29) |
| InChIKey | GBYNEFVNOOCLOR-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|