C23H28N4O3S2 — CID 4245485
ethyl 2-[2-[(3-amino-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)amino]-1,3-thiazol-5-yl]acetate (PubChem CID 4245485) has the molecular formula C23H28N4O3S2 and a molecular weight of 472.64 g/mol. Its IUPAC name is ethyl 2-[2-[(3-amino-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)amino]-1,3-thiazol-5-yl]acetate.
| Compound Name | ethyl 2-[2-[(3-amino-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)amino]-1,3-thiazol-5-yl]acetate |
|---|---|
| PubChem CID | 4245485 |
| Molecular Formula | C23H28N4O3S2 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | ethyl 2-[2-[(3-amino-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)amino]-1,3-thiazol-5-yl]acetate |
| SMILES | CCOC(=O)Cc1cnc(NC(=O)c2sc3nc4c(cc3c2N)CC(C(C)(C)C)CC4)s1 |
| InChI | InChI=1S/C23H28N4O3S2/c1-5-30-17(28)10-14-11-25-22(31-14)27-20(29)19-18(24)15-9-12-8-13(23(2,3)4)6-7-16(12)26-21(15)32-19/h9,11,13H,5-8,10,24H2,1-4H3,(H,25,27,29) |
| InChIKey | JFTCFSQAYOVCTN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |