C27H30N4O2S2 — CID 23801376
3-amino-6-tert-butyl-N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide (PubChem CID 23801376) has the molecular formula C27H30N4O2S2 and a molecular weight of 506.70 g/mol. Its IUPAC name is 3-amino-6-tert-butyl-N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | 3-amino-6-tert-butyl-N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 23801376 |
| Molecular Formula | C27H30N4O2S2 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 3-amino-6-tert-butyl-N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| SMILES | CCOc1ccc(-c2csc(NC(=O)c3sc4nc5c(cc4c3N)CC(C(C)(C)C)CC5)n2)cc1 |
| InChI | InChI=1S/C27H30N4O2S2/c1-5-33-18-9-6-15(7-10-18)21-14-34-26(30-21)31-24(32)23-22(28)19-13-16-12-17(27(2,3)4)8-11-20(16)29-25(19)35-23/h6-7,9-10,13-14,17H,5,8,11-12,28H2,1-4H3,(H,30,31,32) |
| InChIKey | QQAVNBXDNOJLCM-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |