C31H34N4O2S2 — CID 23888923
3-amino-6-tert-butyl-N-(3-carbamoyl-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide (PubChem CID 23888923) has the molecular formula C31H34N4O2S2 and a molecular weight of 558.77 g/mol. Its IUPAC name is 3-amino-6-tert-butyl-N-(3-carbamoyl-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | 3-amino-6-tert-butyl-N-(3-carbamoyl-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 23888923 |
| Molecular Formula | C31H34N4O2S2 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | 3-amino-6-tert-butyl-N-(3-carbamoyl-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| SMILES | CC(C)(C)C1CCc2nc3sc(C(=O)Nc4sc5c(c4C(N)=O)CCC(c4ccccc4)C5)c(N)c3cc2C1 |
| InChI | InChI=1S/C31H34N4O2S2/c1-31(2,3)19-10-12-22-18(13-19)14-21-25(32)26(39-29(21)34-22)28(37)35-30-24(27(33)36)20-11-9-17(15-23(20)38-30)16-7-5-4-6-8-16/h4-8,14,17,19H,9-13,15,32H2,1-3H3,(H2,33,36)(H,35,37) |
| InChIKey | NWOSUYWVMISJRW-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |