C30H31N3O3S2 — CID 23830029
ethyl 2-[(3-amino-6-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 23830029) has the molecular formula C30H31N3O3S2 and a molecular weight of 545.73 g/mol. Its IUPAC name is ethyl 2-[(3-amino-6-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(3-amino-6-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23830029 |
| Molecular Formula | C30H31N3O3S2 |
| Molecular Weight | 545.73 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | ethyl 2-[(3-amino-6-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2sc3nc4c(cc3c2N)CC(c2ccccc2)CC4)sc2c1CCCCC2 |
| InChI | InChI=1S/C30H31N3O3S2/c1-2-36-30(35)24-20-11-7-4-8-12-23(20)37-29(24)33-27(34)26-25(31)21-16-19-15-18(17-9-5-3-6-10-17)13-14-22(19)32-28(21)38-26/h3,5-6,9-10,16,18H,2,4,7-8,11-15,31H2,1H3,(H,33,34) |
| InChIKey | OKLSBWDQUCPTDB-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.73 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |