C22H20N4OS2 — CID 23997973
3-amino-N-(4-methyl-1,3-thiazol-2-yl)-6-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide (PubChem CID 23997973) has the molecular formula C22H20N4OS2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 3-amino-N-(4-methyl-1,3-thiazol-2-yl)-6-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | 3-amino-N-(4-methyl-1,3-thiazol-2-yl)-6-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 23997973 |
| Molecular Formula | C22H20N4OS2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 3-amino-N-(4-methyl-1,3-thiazol-2-yl)-6-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| SMILES | Cc1csc(NC(=O)c2sc3nc4c(cc3c2N)CC(c2ccccc2)CC4)n1 |
| InChI | InChI=1S/C22H20N4OS2/c1-12-11-28-22(24-12)26-20(27)19-18(23)16-10-15-9-14(13-5-3-2-4-6-13)7-8-17(15)25-21(16)29-19/h2-6,10-11,14H,7-9,23H2,1H3,(H,24,26,27) |
| InChIKey | HADBXJSQMXJCKB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |