C24H19N3O3S — CID 124585248
[(6R)-3-amino-6-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl]-(4-nitrophenyl)methanone (PubChem CID 124585248) has the molecular formula C24H19N3O3S and a molecular weight of 429.50 g/mol. Its IUPAC name is [(6R)-3-amino-6-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl]-(4-nitrophenyl)methanone.
| Compound Name | [(6R)-3-amino-6-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 124585248 |
| Molecular Formula | C24H19N3O3S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | [(6R)-3-amino-6-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl]-(4-nitrophenyl)methanone |
| SMILES | Nc1c(C(=O)c2ccc([N+](=O)[O-])cc2)sc2nc3c(cc12)C[C@H](c1ccccc1)CC3 |
| InChI | InChI=1S/C24H19N3O3S/c25-21-19-13-17-12-16(14-4-2-1-3-5-14)8-11-20(17)26-24(19)31-23(21)22(28)15-6-9-18(10-7-15)27(29)30/h1-7,9-10,13,16H,8,11-12,25H2/t16-/m1/s1 |
| InChIKey | YPONQXPNSASAQA-MRXNPFEDSA-N |
| XLogP | 5.29 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|