C25H22N4O3S2 — CID 23774821
3-amino-6-methyl-N-[4-(4-nitrophenyl)sulfanylphenyl]-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide (PubChem CID 23774821) has the molecular formula C25H22N4O3S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 3-amino-6-methyl-N-[4-(4-nitrophenyl)sulfanylphenyl]-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | 3-amino-6-methyl-N-[4-(4-nitrophenyl)sulfanylphenyl]-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 23774821 |
| Molecular Formula | C25H22N4O3S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 3-amino-6-methyl-N-[4-(4-nitrophenyl)sulfanylphenyl]-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| SMILES | CC1CCc2nc3sc(C(=O)Nc4ccc(Sc5ccc([N+](=O)[O-])cc5)cc4)c(N)c3cc2C1 |
| InChI | InChI=1S/C25H22N4O3S2/c1-14-2-11-21-15(12-14)13-20-22(26)23(34-25(20)28-21)24(30)27-16-3-7-18(8-4-16)33-19-9-5-17(6-10-19)29(31)32/h3-10,13-14H,2,11-12,26H2,1H3,(H,27,30) |
| InChIKey | ZPBXXKVGRPCZGR-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|