C23H20N4O3S2 — CID 23944857
3-amino-N-[4-(4-nitrophenyl)sulfanylphenyl]-6-propylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 23944857) has the molecular formula C23H20N4O3S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is 3-amino-N-[4-(4-nitrophenyl)sulfanylphenyl]-6-propylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[4-(4-nitrophenyl)sulfanylphenyl]-6-propylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 23944857 |
| Molecular Formula | C23H20N4O3S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 3-amino-N-[4-(4-nitrophenyl)sulfanylphenyl]-6-propylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CCCc1ccc2c(N)c(C(=O)Nc3ccc(Sc4ccc([N+](=O)[O-])cc4)cc3)sc2n1 |
| InChI | InChI=1S/C23H20N4O3S2/c1-2-3-14-6-13-19-20(24)21(32-23(19)26-14)22(28)25-15-4-9-17(10-5-15)31-18-11-7-16(8-12-18)27(29)30/h4-13H,2-3,24H2,1H3,(H,25,28) |
| InChIKey | RBGXQEJPYDACHP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|