C23H19ClN4OS — CID 4074447
3-amino-N-(2-chloro-3-pyridinyl)-6-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide (PubChem CID 4074447) has the molecular formula C23H19ClN4OS and a molecular weight of 434.95 g/mol. Its IUPAC name is 3-amino-N-(2-chloro-3-pyridinyl)-6-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | 3-amino-N-(2-chloro-3-pyridinyl)-6-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 4074447 |
| Molecular Formula | C23H19ClN4OS |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 3-amino-N-(2-chloro-3-pyridinyl)-6-phenyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| SMILES | Nc1c(C(=O)Nc2cccnc2Cl)sc2nc3c(cc12)CC(c1ccccc1)CC3 |
| InChI | InChI=1S/C23H19ClN4OS/c24-21-18(7-4-10-26-21)27-22(29)20-19(25)16-12-15-11-14(13-5-2-1-3-6-13)8-9-17(15)28-23(16)30-20/h1-7,10,12,14H,8-9,11,25H2,(H,27,29) |
| InChIKey | VTVCDHGWRWFMKN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|