C26H24N4O2S2 — CID 23774785
6-amino-N-(3-carbamoyl-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8-tetraene-5-carboxamide (PubChem CID 23774785) has the molecular formula C26H24N4O2S2 and a molecular weight of 488.64 g/mol. Its IUPAC name is 6-amino-N-(3-carbamoyl-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8-tetraene-5-carboxamide.
| Compound Name | 6-amino-N-(3-carbamoyl-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 23774785 |
| Molecular Formula | C26H24N4O2S2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 6-amino-N-(3-carbamoyl-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8-tetraene-5-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)c2sc3nc4c(cc3c2N)CCC4)sc2c1CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C26H24N4O2S2/c27-21-17-11-15-7-4-8-18(15)29-25(17)34-22(21)24(32)30-26-20(23(28)31)16-10-9-14(12-19(16)33-26)13-5-2-1-3-6-13/h1-3,5-6,11,14H,4,7-10,12,27H2,(H2,28,31)(H,30,32) |
| InChIKey | PCBHKRINLZETGI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |