C25H21N3O3S2 — CID 23858349
methyl 2-[(6-amino-4-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8-tetraene-5-carbonyl)amino]-4,5-dihydrobenzo[g][1]benzothiole-3-carboxylate (PubChem CID 23858349) has the molecular formula C25H21N3O3S2 and a molecular weight of 475.60 g/mol. Its IUPAC name is methyl 2-[(6-amino-4-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8-tetraene-5-carbonyl)amino]-4,5-dihydrobenzo[g][1]benzothiole-3-carboxylate.
| Compound Name | methyl 2-[(6-amino-4-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8-tetraene-5-carbonyl)amino]-4,5-dihydrobenzo[g][1]benzothiole-3-carboxylate |
|---|---|
| PubChem CID | 23858349 |
| Molecular Formula | C25H21N3O3S2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | methyl 2-[(6-amino-4-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8-tetraene-5-carbonyl)amino]-4,5-dihydrobenzo[g][1]benzothiole-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2sc3nc4c(cc3c2N)CCC4)sc2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C25H21N3O3S2/c1-31-25(30)18-15-10-9-12-5-2-3-7-14(12)20(15)32-24(18)28-22(29)21-19(26)16-11-13-6-4-8-17(13)27-23(16)33-21/h2-3,5,7,11H,4,6,8-10,26H2,1H3,(H,28,29) |
| InChIKey | YJGMWOIBRVLZGF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |