C9H6ClN5O3S — CID 80617284
5-amino-N-(2-chloro-5-nitrophenyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80617284) has the molecular formula C9H6ClN5O3S and a molecular weight of 299.70 g/mol. Its IUPAC name is 5-amino-N-(2-chloro-5-nitrophenyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-amino-N-(2-chloro-5-nitrophenyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80617284 |
| Molecular Formula | C9H6ClN5O3S |
| Molecular Weight | 299.70 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 5-amino-N-(2-chloro-5-nitrophenyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | Nc1nnc(C(=O)Nc2cc([N+](=O)[O-])ccc2Cl)s1 |
| InChI | InChI=1S/C9H6ClN5O3S/c10-5-2-1-4(15(17)18)3-6(5)12-7(16)8-13-14-9(11)19-8/h1-3H,(H2,11,14)(H,12,16) |
| InChIKey | TUWMCTWMESUTIX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.70 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|