C19H18N4O4S — CID 39975723
2-cyclopropyl-N-(2-methoxy-4-nitrophenyl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 39975723) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is 2-cyclopropyl-N-(2-methoxy-4-nitrophenyl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-cyclopropyl-N-(2-methoxy-4-nitrophenyl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 39975723 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-cyclopropyl-N-(2-methoxy-4-nitrophenyl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)c1sc2nc(C3CC3)nc(C)c2c1C |
| InChI | InChI=1S/C19H18N4O4S/c1-9-15-10(2)20-17(11-4-5-11)22-19(15)28-16(9)18(24)21-13-7-6-12(23(25)26)8-14(13)27-3/h6-8,11H,4-5H2,1-3H3,(H,21,24) |
| InChIKey | YUSOTEPZMWMZHY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|