C25H30N4O4S — CID 30706839
2-cyclopropyl-N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide (PubChem CID 30706839) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is 2-cyclopropyl-N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide.
| Compound Name | 2-cyclopropyl-N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide |
|---|---|
| PubChem CID | 30706839 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 2-cyclopropyl-N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2sc3nc(C4CC4)nc(C)c3c2C)ccc1OCCC(C)C |
| InChI | InChI=1S/C25H30N4O4S/c1-13(2)10-11-33-18-9-8-17(12-19(18)32-5)23(30)28-29-24(31)21-14(3)20-15(4)26-22(16-6-7-16)27-25(20)34-21/h8-9,12-13,16H,6-7,10-11H2,1-5H3,(H,28,30)(H,29,31) |
| InChIKey | NXOHBFTYEULHHG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|