C23H27N3O2S — CID 46550056
2-cyclopropyl-4,5-dimethyl-N-[3-(1-phenylethoxy)propyl]thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 46550056) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is 2-cyclopropyl-4,5-dimethyl-N-[3-(1-phenylethoxy)propyl]thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-cyclopropyl-4,5-dimethyl-N-[3-(1-phenylethoxy)propyl]thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 46550056 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-cyclopropyl-4,5-dimethyl-N-[3-(1-phenylethoxy)propyl]thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1nc(C2CC2)nc2sc(C(=O)NCCCOC(C)c3ccccc3)c(C)c12 |
| InChI | InChI=1S/C23H27N3O2S/c1-14-19-15(2)25-21(18-10-11-18)26-23(19)29-20(14)22(27)24-12-7-13-28-16(3)17-8-5-4-6-9-17/h4-6,8-9,16,18H,7,10-13H2,1-3H3,(H,24,27) |
| InChIKey | JFAABXLJWIKLIP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|