C20H23N5O4 — CID 24535877
N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-2H-benzotriazole-5-carbohydrazide (PubChem CID 24535877) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-2H-benzotriazole-5-carbohydrazide.
| Compound Name | N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-2H-benzotriazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24535877 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-2H-benzotriazole-5-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2ccc3n[nH]nc3c2)ccc1OCCC(C)C |
| InChI | InChI=1S/C20H23N5O4/c1-12(2)8-9-29-17-7-5-14(11-18(17)28-3)20(27)24-23-19(26)13-4-6-15-16(10-13)22-25-21-15/h4-7,10-12H,8-9H2,1-3H3,(H,23,26)(H,24,27)(H,21,22,25) |
| InChIKey | ZCMYFSJXEQHSLY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|