C20H24FNO3 — CID 112791004
N-[(4-fluorophenyl)methyl]-3-methoxy-4-(3-methylbutoxy)benzamide (PubChem CID 112791004) has the molecular formula C20H24FNO3 and a molecular weight of 345.41 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-methoxy-4-(3-methylbutoxy)benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-methoxy-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 112791004 |
| Molecular Formula | C20H24FNO3 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-methoxy-4-(3-methylbutoxy)benzamide |
| SMILES | COc1cc(C(=O)NCc2ccc(F)cc2)ccc1OCCC(C)C |
| InChI | InChI=1S/C20H24FNO3/c1-14(2)10-11-25-18-9-6-16(12-19(18)24-3)20(23)22-13-15-4-7-17(21)8-5-15/h4-9,12,14H,10-11,13H2,1-3H3,(H,22,23) |
| InChIKey | JIHRZZCPHAXMGL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |