C22H24FN3O4 — CID 46556890
5-fluoro-N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-1H-indole-2-carbohydrazide (PubChem CID 46556890) has the molecular formula C22H24FN3O4 and a molecular weight of 413.45 g/mol. Its IUPAC name is 5-fluoro-N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-1H-indole-2-carbohydrazide.
| Compound Name | 5-fluoro-N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-1H-indole-2-carbohydrazide |
|---|---|
| PubChem CID | 46556890 |
| Molecular Formula | C22H24FN3O4 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 5-fluoro-N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-1H-indole-2-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2cc3cc(F)ccc3[nH]2)ccc1OCCC(C)C |
| InChI | InChI=1S/C22H24FN3O4/c1-13(2)8-9-30-19-7-4-14(12-20(19)29-3)21(27)25-26-22(28)18-11-15-10-16(23)5-6-17(15)24-18/h4-7,10-13,24H,8-9H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | HCLKDLXDUWJBCV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|