C20H30N2O4 — CID 72689752
N'-(4,4-dimethylpent-2-enoyl)-3-methoxy-4-(3-methylbutoxy)benzohydrazide (PubChem CID 72689752) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is N'-(4,4-dimethylpent-2-enoyl)-3-methoxy-4-(3-methylbutoxy)benzohydrazide.
| Compound Name | N'-(4,4-dimethylpent-2-enoyl)-3-methoxy-4-(3-methylbutoxy)benzohydrazide |
|---|---|
| PubChem CID | 72689752 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | N'-(4,4-dimethylpent-2-enoyl)-3-methoxy-4-(3-methylbutoxy)benzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)C=CC(C)(C)C)ccc1OCCC(C)C |
| InChI | InChI=1S/C20H30N2O4/c1-14(2)10-12-26-16-8-7-15(13-17(16)25-6)19(24)22-21-18(23)9-11-20(3,4)5/h7-9,11,13-14H,10,12H2,1-6H3,(H,21,23)(H,22,24) |
| InChIKey | OEXLWKQLXGISQF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|