C19H23NO4 — CID 51186820
N-(4-hydroxyphenyl)-3-methoxy-4-(3-methylbutoxy)benzamide (PubChem CID 51186820) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-3-methoxy-4-(3-methylbutoxy)benzamide.
| Compound Name | N-(4-hydroxyphenyl)-3-methoxy-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 51186820 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-(4-hydroxyphenyl)-3-methoxy-4-(3-methylbutoxy)benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(O)cc2)ccc1OCCC(C)C |
| InChI | InChI=1S/C19H23NO4/c1-13(2)10-11-24-17-9-4-14(12-18(17)23-3)19(22)20-15-5-7-16(21)8-6-15/h4-9,12-13,21H,10-11H2,1-3H3,(H,20,22) |
| InChIKey | GJWBLEXLXPUQQO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|