C19H24N2O4S — CID 30882214
N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-3-methylthiophene-2-carbohydrazide (PubChem CID 30882214) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-3-methylthiophene-2-carbohydrazide.
| Compound Name | N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-3-methylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 30882214 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N'-[3-methoxy-4-(3-methylbutoxy)benzoyl]-3-methylthiophene-2-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2sccc2C)ccc1OCCC(C)C |
| InChI | InChI=1S/C19H24N2O4S/c1-12(2)7-9-25-15-6-5-14(11-16(15)24-4)18(22)20-21-19(23)17-13(3)8-10-26-17/h5-6,8,10-12H,7,9H2,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | LMIJJEDASAFPEM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|