C22H26N4O5S — CID 31724259
3-methoxy-4-(3-methylbutoxy)-N'-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanoyl]benzohydrazide (PubChem CID 31724259) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is 3-methoxy-4-(3-methylbutoxy)-N'-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanoyl]benzohydrazide.
| Compound Name | 3-methoxy-4-(3-methylbutoxy)-N'-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 31724259 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 3-methoxy-4-(3-methylbutoxy)-N'-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanoyl]benzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)CCc2nc(-c3cccs3)no2)ccc1OCCC(C)C |
| InChI | InChI=1S/C22H26N4O5S/c1-14(2)10-11-30-16-7-6-15(13-17(16)29-3)22(28)25-24-19(27)8-9-20-23-21(26-31-20)18-5-4-12-32-18/h4-7,12-14H,8-11H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | NZRNNEWKGHCYMP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|