C21H30N4O5 — CID 35694034
3-methoxy-4-(3-methylbutoxy)-N'-[3-(3-propyl-1,2,4-oxadiazol-5-yl)propanoyl]benzohydrazide (PubChem CID 35694034) has the molecular formula C21H30N4O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is 3-methoxy-4-(3-methylbutoxy)-N'-[3-(3-propyl-1,2,4-oxadiazol-5-yl)propanoyl]benzohydrazide.
| Compound Name | 3-methoxy-4-(3-methylbutoxy)-N'-[3-(3-propyl-1,2,4-oxadiazol-5-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 35694034 |
| Molecular Formula | C21H30N4O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 3-methoxy-4-(3-methylbutoxy)-N'-[3-(3-propyl-1,2,4-oxadiazol-5-yl)propanoyl]benzohydrazide |
| SMILES | CCCc1noc(CCC(=O)NNC(=O)c2ccc(OCCC(C)C)c(OC)c2)n1 |
| InChI | InChI=1S/C21H30N4O5/c1-5-6-18-22-20(30-25-18)10-9-19(26)23-24-21(27)15-7-8-16(17(13-15)28-4)29-12-11-14(2)3/h7-8,13-14H,5-6,9-12H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | GTVRUPARMBRHAW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|