C21H29N3O5S — CID 29403518
N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetyl]-3-methoxy-4-(3-methylbutoxy)benzohydrazide (PubChem CID 29403518) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetyl]-3-methoxy-4-(3-methylbutoxy)benzohydrazide.
| Compound Name | N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetyl]-3-methoxy-4-(3-methylbutoxy)benzohydrazide |
|---|---|
| PubChem CID | 29403518 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetyl]-3-methoxy-4-(3-methylbutoxy)benzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)CSCc2c(C)noc2C)ccc1OCCC(C)C |
| InChI | InChI=1S/C21H29N3O5S/c1-13(2)8-9-28-18-7-6-16(10-19(18)27-5)21(26)23-22-20(25)12-30-11-17-14(3)24-29-15(17)4/h6-7,10,13H,8-9,11-12H2,1-5H3,(H,22,25)(H,23,26) |
| InChIKey | RKZPUKLFOGEUDP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|