C20H31NO5 — CID 55670323
methyl 2-[[3-methoxy-4-(3-methylbutoxy)benzoyl]amino]-2-methylpentanoate (PubChem CID 55670323) has the molecular formula C20H31NO5 and a molecular weight of 365.47 g/mol. Its IUPAC name is methyl 2-[[3-methoxy-4-(3-methylbutoxy)benzoyl]amino]-2-methylpentanoate.
| Compound Name | methyl 2-[[3-methoxy-4-(3-methylbutoxy)benzoyl]amino]-2-methylpentanoate |
|---|---|
| PubChem CID | 55670323 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | methyl 2-[[3-methoxy-4-(3-methylbutoxy)benzoyl]amino]-2-methylpentanoate |
| SMILES | CCCC(C)(NC(=O)c1ccc(OCCC(C)C)c(OC)c1)C(=O)OC |
| InChI | InChI=1S/C20H31NO5/c1-7-11-20(4,19(23)25-6)21-18(22)15-8-9-16(17(13-15)24-5)26-12-10-14(2)3/h8-9,13-14H,7,10-12H2,1-6H3,(H,21,22) |
| InChIKey | UQPJLYDFEVULQW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |