C18H29NO3 — CID 75872470
N-butan-2-yl-3-methoxy-N-methyl-4-(3-methylbutoxy)benzamide (PubChem CID 75872470) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is N-butan-2-yl-3-methoxy-N-methyl-4-(3-methylbutoxy)benzamide.
| Compound Name | N-butan-2-yl-3-methoxy-N-methyl-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 75872470 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | N-butan-2-yl-3-methoxy-N-methyl-4-(3-methylbutoxy)benzamide |
| SMILES | CCC(C)N(C)C(=O)c1ccc(OCCC(C)C)c(OC)c1 |
| InChI | InChI=1S/C18H29NO3/c1-7-14(4)19(5)18(20)15-8-9-16(17(12-15)21-6)22-11-10-13(2)3/h8-9,12-14H,7,10-11H2,1-6H3 |
| InChIKey | PIJMPNWBPGPFEB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |