C15H13N5O3 — CID 24535861
N'-(4-methoxybenzoyl)-2H-benzotriazole-5-carbohydrazide (PubChem CID 24535861) has the molecular formula C15H13N5O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is N'-(4-methoxybenzoyl)-2H-benzotriazole-5-carbohydrazide.
| Compound Name | N'-(4-methoxybenzoyl)-2H-benzotriazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24535861 |
| Molecular Formula | C15H13N5O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N'-(4-methoxybenzoyl)-2H-benzotriazole-5-carbohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2ccc3n[nH]nc3c2)cc1 |
| InChI | InChI=1S/C15H13N5O3/c1-23-11-5-2-9(3-6-11)14(21)18-19-15(22)10-4-7-12-13(8-10)17-20-16-12/h2-8H,1H3,(H,18,21)(H,19,22)(H,16,17,20) |
| InChIKey | CYCGCWPQZLONQH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|