C9H10N4O2 — CID 47143794
N-ethoxy-2H-benzotriazole-5-carboxamide (PubChem CID 47143794) has the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. Its IUPAC name is N-ethoxy-2H-benzotriazole-5-carboxamide.
| Compound Name | N-ethoxy-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 47143794 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | N-ethoxy-2H-benzotriazole-5-carboxamide |
| SMILES | CCONC(=O)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C9H10N4O2/c1-2-15-12-9(14)6-3-4-7-8(5-6)11-13-10-7/h3-5H,2H2,1H3,(H,12,14)(H,10,11,13) |
| InChIKey | HPHDWCAFBWRUIZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|