C13H18N4O2 — CID 65114221
N-(2-ethyl-2-hydroxybutyl)-2H-benzotriazole-5-carboxamide (PubChem CID 65114221) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-(2-ethyl-2-hydroxybutyl)-2H-benzotriazole-5-carboxamide.
| Compound Name | N-(2-ethyl-2-hydroxybutyl)-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 65114221 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | N-(2-ethyl-2-hydroxybutyl)-2H-benzotriazole-5-carboxamide |
| SMILES | CCC(O)(CC)CNC(=O)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C13H18N4O2/c1-3-13(19,4-2)8-14-12(18)9-5-6-10-11(7-9)16-17-15-10/h5-7,19H,3-4,8H2,1-2H3,(H,14,18)(H,15,16,17) |
| InChIKey | YKDDRDMIUZUVGA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |