C14H18F3NO2 — CID 65112295
N-(2-ethyl-2-hydroxybutyl)-4-(trifluoromethyl)benzamide (PubChem CID 65112295) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is N-(2-ethyl-2-hydroxybutyl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(2-ethyl-2-hydroxybutyl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 65112295 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-(2-ethyl-2-hydroxybutyl)-4-(trifluoromethyl)benzamide |
| SMILES | CCC(O)(CC)CNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H18F3NO2/c1-3-13(20,4-2)9-18-12(19)10-5-7-11(8-6-10)14(15,16)17/h5-8,20H,3-4,9H2,1-2H3,(H,18,19) |
| InChIKey | YFILZSHHILXTMB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |