C15H23NO3 — CID 65112007
N-(2-ethyl-2-hydroxybutyl)-4-(methoxymethyl)benzamide (PubChem CID 65112007) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is N-(2-ethyl-2-hydroxybutyl)-4-(methoxymethyl)benzamide.
| Compound Name | N-(2-ethyl-2-hydroxybutyl)-4-(methoxymethyl)benzamide |
|---|---|
| PubChem CID | 65112007 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | N-(2-ethyl-2-hydroxybutyl)-4-(methoxymethyl)benzamide |
| SMILES | CCC(O)(CC)CNC(=O)c1ccc(COC)cc1 |
| InChI | InChI=1S/C15H23NO3/c1-4-15(18,5-2)11-16-14(17)13-8-6-12(7-9-13)10-19-3/h6-9,18H,4-5,10-11H2,1-3H3,(H,16,17) |
| InChIKey | QBXZCZDJBAEEBG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |