C12H13N5O4 — CID 6737317
ethyl 3-[2-(2H-benzotriazole-5-carbonyl)hydrazinyl]-3-oxopropanoate (PubChem CID 6737317) has the molecular formula C12H13N5O4 and a molecular weight of 291.27 g/mol. Its IUPAC name is ethyl 3-[2-(2H-benzotriazole-5-carbonyl)hydrazinyl]-3-oxopropanoate.
| Compound Name | ethyl 3-[2-(2H-benzotriazole-5-carbonyl)hydrazinyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 6737317 |
| Molecular Formula | C12H13N5O4 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | ethyl 3-[2-(2H-benzotriazole-5-carbonyl)hydrazinyl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)NNC(=O)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C12H13N5O4/c1-2-21-11(19)6-10(18)15-16-12(20)7-3-4-8-9(5-7)14-17-13-8/h3-5H,2,6H2,1H3,(H,15,18)(H,16,20)(H,13,14,17) |
| InChIKey | WGRAHIAUBPUTAC-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|