C14H18N2O4 — CID 5119710
ethyl 4-[2-(3-methylbenzoyl)hydrazinyl]-4-oxobutanoate (PubChem CID 5119710) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is ethyl 4-[2-(3-methylbenzoyl)hydrazinyl]-4-oxobutanoate.
| Compound Name | ethyl 4-[2-(3-methylbenzoyl)hydrazinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 5119710 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | ethyl 4-[2-(3-methylbenzoyl)hydrazinyl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NNC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C14H18N2O4/c1-3-20-13(18)8-7-12(17)15-16-14(19)11-6-4-5-10(2)9-11/h4-6,9H,3,7-8H2,1-2H3,(H,15,17)(H,16,19) |
| InChIKey | SRZQUILCZFAPMR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|