C14H18N2O2S — CID 65112231
N-(2-ethyl-2-hydroxybutyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 65112231) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is N-(2-ethyl-2-hydroxybutyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(2-ethyl-2-hydroxybutyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 65112231 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | N-(2-ethyl-2-hydroxybutyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | CCC(O)(CC)CNC(=O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H18N2O2S/c1-3-14(18,4-2)8-15-13(17)10-5-6-11-12(7-10)19-9-16-11/h5-7,9,18H,3-4,8H2,1-2H3,(H,15,17) |
| InChIKey | SGNXBZPYVISMJE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |