C16H22N2OS — CID 143657790
N-but-2-ynyl-1,3-benzothiazole-6-carboxamide;ethane (PubChem CID 143657790) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is N-but-2-ynyl-1,3-benzothiazole-6-carboxamide;ethane.
| Compound Name | N-but-2-ynyl-1,3-benzothiazole-6-carboxamide;ethane |
|---|---|
| PubChem CID | 143657790 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N-but-2-ynyl-1,3-benzothiazole-6-carboxamide;ethane |
| SMILES | CC.CC.CC#CCNC(=O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C12H10N2OS.2C2H6/c1-2-3-6-13-12(15)9-4-5-10-11(7-9)16-8-14-10;2*1-2/h4-5,7-8H,6H2,1H3,(H,13,15);2*1-2H3 |
| InChIKey | UXVWAZDNIXCHBD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|