C19H13F3N2O2S — CID 90575791
N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]-1,3-benzothiazole-6-carboxamide (PubChem CID 90575791) has the molecular formula C19H13F3N2O2S and a molecular weight of 390.39 g/mol. Its IUPAC name is N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 90575791 |
| Molecular Formula | C19H13F3N2O2S |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(NCC#CCOc1cccc(C(F)(F)F)c1)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C19H13F3N2O2S/c20-19(21,22)14-4-3-5-15(11-14)26-9-2-1-8-23-18(25)13-6-7-16-17(10-13)27-12-24-16/h3-7,10-12H,8-9H2,(H,23,25) |
| InChIKey | MGGNDCQBIPOMHY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|