C21H15N3O2S — CID 90580027
N-(4-quinolin-7-yloxybut-2-ynyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 90580027) has the molecular formula C21H15N3O2S and a molecular weight of 373.44 g/mol. Its IUPAC name is N-(4-quinolin-7-yloxybut-2-ynyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(4-quinolin-7-yloxybut-2-ynyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 90580027 |
| Molecular Formula | C21H15N3O2S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N-(4-quinolin-7-yloxybut-2-ynyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(NCC#CCOc1ccc2cccnc2c1)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C21H15N3O2S/c25-21(16-6-8-18-20(12-16)27-14-24-18)23-9-1-2-11-26-17-7-5-15-4-3-10-22-19(15)13-17/h3-8,10,12-14H,9,11H2,(H,23,25) |
| InChIKey | CHZRFHHGOVLNHP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|