C12H14N2OS — CID 60635901
N,N-diethyl-1,3-benzothiazole-6-carboxamide (PubChem CID 60635901) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is N,N-diethyl-1,3-benzothiazole-6-carboxamide.
| Compound Name | N,N-diethyl-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 60635901 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N,N-diethyl-1,3-benzothiazole-6-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C12H14N2OS/c1-3-14(4-2)12(15)9-5-6-10-11(7-9)16-8-13-10/h5-8H,3-4H2,1-2H3 |
| InChIKey | CKLULGYKMPCZDZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |