ethyl 2-[1,3-benzothiazole-6-carbonyl(propyl)amino]acetate

C15H18N2O3S — CID 61012902

IUPACethyl 2-[1,3-benzothiazole-6-carbonyl(propyl)amino]acetate
SMILESCCCN(CC(=O)OCC)C(=O)c1ccc2ncsc2c1
InChIInChI=1S/C15H18N2O3S/c1-3-7-17(9-14(18)20-4-2)15(19)11-5-6-12-13(8-11)21-10-16-12/h5-6,8,10H,3-4,7,9H2,1-2H3
InChIKeyLGSVMZGFQJOBNX-UHFFFAOYSA-N
MW306.39 g/mol
LogP2.71
Rot. Bonds6

About ethyl 2-[1,3-benzothiazole-6-carbonyl(propyl)amino]acetate

ethyl 2-[1,3-benzothiazole-6-carbonyl(propyl)amino]acetate (PubChem CID 61012902) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is ethyl 2-[1,3-benzothiazole-6-carbonyl(propyl)amino]acetate.

Molecular Properties

Compound Nameethyl 2-[1,3-benzothiazole-6-carbonyl(propyl)amino]acetate
PubChem CID61012902
Molecular FormulaC15H18N2O3S
Molecular Weight306.39 g/mol
Exact Mass306.10
IUPAC Nameethyl 2-[1,3-benzothiazole-6-carbonyl(propyl)amino]acetate
SMILESCCCN(CC(=O)OCC)C(=O)c1ccc2ncsc2c1
InChIInChI=1S/C15H18N2O3S/c1-3-7-17(9-14(18)20-4-2)15(19)11-5-6-12-13(8-11)21-10-16-12/h5-6,8,10H,3-4,7,9H2,1-2H3
InChIKeyLGSVMZGFQJOBNX-UHFFFAOYSA-N
XLogP2.71
TPSA59.50 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.39
LogP ≤ 52.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 2-[1,3-benzothiazole-6-carbonyl(propyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-[1,3-benzothiazole-6-carbonyl(propyl)amino]acetate?
The IUPAC name of ethyl 2-[1,3-benzothiazole-6-carbonyl(propyl)amino]acetate (CID 61012902) is ethyl 2-[1,3-benzothiazole-6-carbonyl(propyl)amino]acetate.
What is the SMILES notation for ethyl 2-[1,3-benzothiazole-6-carbonyl(propyl)amino]acetate?
The canonical SMILES for ethyl 2-[1,3-benzothiazole-6-carbonyl(propyl)amino]acetate is CCCN(CC(=O)OCC)C(=O)c1ccc2ncsc2c1.
What is the InChIKey of ethyl 2-[1,3-benzothiazole-6-carbonyl(propyl)amino]acetate?
The InChIKey is LGSVMZGFQJOBNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3S/c1-3-7-17(9-14(18)20-4-2)15(19)11-5-6-12-13(8-11)21-10-16-12/h5-6,8,10H,3-4,7,9H2,1-2H3.
What are the key properties of ethyl 2-[1,3-benzothiazole-6-carbonyl(propyl)amino]acetate?
ethyl 2-[1,3-benzothiazole-6-carbonyl(propyl)amino]acetate has a molecular weight of 306.39 g/mol, XLogP of 2.71, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1,3-benzothiazole-6-carbonyl(propyl)amino]acetate is sourced from PubChem (CID 61012902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).