C23H21N5O6 — CID 43070155
2-N',6-N'-bis(4-methoxybenzoyl)pyridine-2,6-dicarbohydrazide (PubChem CID 43070155) has the molecular formula C23H21N5O6 and a molecular weight of 463.45 g/mol. Its IUPAC name is 2-N',6-N'-bis(4-methoxybenzoyl)pyridine-2,6-dicarbohydrazide.
| Compound Name | 2-N',6-N'-bis(4-methoxybenzoyl)pyridine-2,6-dicarbohydrazide |
|---|---|
| PubChem CID | 43070155 |
| Molecular Formula | C23H21N5O6 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 2-N',6-N'-bis(4-methoxybenzoyl)pyridine-2,6-dicarbohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2cccc(C(=O)NNC(=O)c3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C23H21N5O6/c1-33-16-10-6-14(7-11-16)20(29)25-27-22(31)18-4-3-5-19(24-18)23(32)28-26-21(30)15-8-12-17(34-2)13-9-15/h3-13H,1-2H3,(H,25,29)(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | WALKEXOVBPRIDY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 147.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|