C15H13N3O5 — CID 167976818
6-[[(4-methoxybenzoyl)amino]carbamoyl]pyridine-3-carboxylic acid (PubChem CID 167976818) has the molecular formula C15H13N3O5 and a molecular weight of 315.29 g/mol. Its IUPAC name is 6-[[(4-methoxybenzoyl)amino]carbamoyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[[(4-methoxybenzoyl)amino]carbamoyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 167976818 |
| Molecular Formula | C15H13N3O5 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 6-[[(4-methoxybenzoyl)amino]carbamoyl]pyridine-3-carboxylic acid |
| SMILES | COc1ccc(C(=O)NNC(=O)c2ccc(C(=O)O)cn2)cc1 |
| InChI | InChI=1S/C15H13N3O5/c1-23-11-5-2-9(3-6-11)13(19)17-18-14(20)12-7-4-10(8-16-12)15(21)22/h2-8H,1H3,(H,17,19)(H,18,20)(H,21,22) |
| InChIKey | YZIYWSBOYCTRJL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|