C21H15Cl2N5O4 — CID 43063875
2-N',6-N'-bis(4-chlorobenzoyl)pyridine-2,6-dicarbohydrazide (PubChem CID 43063875) has the molecular formula C21H15Cl2N5O4 and a molecular weight of 472.29 g/mol. Its IUPAC name is 2-N',6-N'-bis(4-chlorobenzoyl)pyridine-2,6-dicarbohydrazide.
| Compound Name | 2-N',6-N'-bis(4-chlorobenzoyl)pyridine-2,6-dicarbohydrazide |
|---|---|
| PubChem CID | 43063875 |
| Molecular Formula | C21H15Cl2N5O4 |
| Molecular Weight | 472.29 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | 2-N',6-N'-bis(4-chlorobenzoyl)pyridine-2,6-dicarbohydrazide |
| SMILES | O=C(NNC(=O)c1cccc(C(=O)NNC(=O)c2ccc(Cl)cc2)n1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H15Cl2N5O4/c22-14-8-4-12(5-9-14)18(29)25-27-20(31)16-2-1-3-17(24-16)21(32)28-26-19(30)13-6-10-15(23)11-7-13/h1-11H,(H,25,29)(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | ZIZWDOBLJOEOAB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|