C21H16ClN3O3 — CID 1100705
N-[4-[[(4-chlorobenzoyl)amino]carbamoyl]phenyl]benzamide (PubChem CID 1100705) has the molecular formula C21H16ClN3O3 and a molecular weight of 393.83 g/mol. Its IUPAC name is N-[4-[[(4-chlorobenzoyl)amino]carbamoyl]phenyl]benzamide.
| Compound Name | N-[4-[[(4-chlorobenzoyl)amino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 1100705 |
| Molecular Formula | C21H16ClN3O3 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | N-[4-[[(4-chlorobenzoyl)amino]carbamoyl]phenyl]benzamide |
| SMILES | O=C(NNC(=O)c1ccc(NC(=O)c2ccccc2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16ClN3O3/c22-17-10-6-15(7-11-17)20(27)24-25-21(28)16-8-12-18(13-9-16)23-19(26)14-4-2-1-3-5-14/h1-13H,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | ZNJWSSLCQQBWNT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|