C21H15ClN2O4 — CID 22672074
4-[(2-benzamido-5-chlorobenzoyl)amino]benzoic acid (PubChem CID 22672074) has the molecular formula C21H15ClN2O4 and a molecular weight of 394.81 g/mol. Its IUPAC name is 4-[(2-benzamido-5-chlorobenzoyl)amino]benzoic acid.
| Compound Name | 4-[(2-benzamido-5-chlorobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 22672074 |
| Molecular Formula | C21H15ClN2O4 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 4-[(2-benzamido-5-chlorobenzoyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2cc(Cl)ccc2NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H15ClN2O4/c22-15-8-11-18(24-19(25)13-4-2-1-3-5-13)17(12-15)20(26)23-16-9-6-14(7-10-16)21(27)28/h1-12H,(H,23,26)(H,24,25)(H,27,28) |
| InChIKey | NPLYHTKKPWMPBB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |