C21H16Cl2N2O3 — CID 59047862
4-[[5-chloro-2-[(3-chlorophenyl)methylamino]benzoyl]amino]benzoic acid (PubChem CID 59047862) has the molecular formula C21H16Cl2N2O3 and a molecular weight of 415.28 g/mol. Its IUPAC name is 4-[[5-chloro-2-[(3-chlorophenyl)methylamino]benzoyl]amino]benzoic acid.
| Compound Name | 4-[[5-chloro-2-[(3-chlorophenyl)methylamino]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 59047862 |
| Molecular Formula | C21H16Cl2N2O3 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 4-[[5-chloro-2-[(3-chlorophenyl)methylamino]benzoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2cc(Cl)ccc2NCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H16Cl2N2O3/c22-15-3-1-2-13(10-15)12-24-19-9-6-16(23)11-18(19)20(26)25-17-7-4-14(5-8-17)21(27)28/h1-11,24H,12H2,(H,25,26)(H,27,28) |
| InChIKey | XAPNYPSSVXKJSM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |