C21H19ClN2O3 — CID 161363812
3-[[2-(benzylamino)-5-chlorobenzoyl]amino]benzoic acid;molecular hydrogen (PubChem CID 161363812) has the molecular formula C21H19ClN2O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is 3-[[2-(benzylamino)-5-chlorobenzoyl]amino]benzoic acid;molecular hydrogen.
| Compound Name | 3-[[2-(benzylamino)-5-chlorobenzoyl]amino]benzoic acid;molecular hydrogen |
|---|---|
| PubChem CID | 161363812 |
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 3-[[2-(benzylamino)-5-chlorobenzoyl]amino]benzoic acid;molecular hydrogen |
| SMILES | O=C(O)c1cccc(NC(=O)c2cc(Cl)ccc2NCc2ccccc2)c1.[H][H] |
| InChI | InChI=1S/C21H17ClN2O3.H2/c22-16-9-10-19(23-13-14-5-2-1-3-6-14)18(12-16)20(25)24-17-8-4-7-15(11-17)21(26)27;/h1-12,23H,13H2,(H,24,25)(H,26,27);1H |
| InChIKey | VPNVAJPHCWIBDO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |