About 3-[[5-chloro-2-(phenoxyamino)benzoyl]amino]benzoic acid;sulfur monoxide
3-[[5-chloro-2-(phenoxyamino)benzoyl]amino]benzoic acid;sulfur monoxide (PubChem CID 158898396) has the molecular formula C20H15ClN2O5S
and a molecular weight of 430.87 g/mol. Its IUPAC name is 3-[[5-chloro-2-(phenoxyamino)benzoyl]amino]benzoic acid;sulfur monoxide.
Molecular Properties
| Compound Name | 3-[[5-chloro-2-(phenoxyamino)benzoyl]amino]benzoic acid;sulfur monoxide |
| PubChem CID | 158898396 |
| Molecular Formula | C20H15ClN2O5S |
| Molecular Weight | 430.87 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 3-[[5-chloro-2-(phenoxyamino)benzoyl]amino]benzoic acid;sulfur monoxide |
| SMILES | O=C(O)c1cccc(NC(=O)c2cc(Cl)ccc2NOc2ccccc2)c1.O=S |
| InChI | InChI=1S/C20H15ClN2O4.OS/c21-14-9-10-18(23-27-16-7-2-1-3-8-16)17(12-14)19(24)22-15-6-4-5-13(11-15)20(25)26;1-2/h1-12,23H,(H,22,24)(H,25,26); |
| InChIKey | JFCUMWKVSBUIRV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.87 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[[5-chloro-2-(phenoxyamino)benzoyl]amino]benzoic acid;sulfur monoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-chloro-2-(phenoxyamino)benzoyl]amino]benzoic acid;sulfur monoxide?
The IUPAC name of 3-[[5-chloro-2-(phenoxyamino)benzoyl]amino]benzoic acid;sulfur monoxide (CID 158898396) is 3-[[5-chloro-2-(phenoxyamino)benzoyl]amino]benzoic acid;sulfur monoxide.
What is the SMILES notation for 3-[[5-chloro-2-(phenoxyamino)benzoyl]amino]benzoic acid;sulfur monoxide?
The canonical SMILES for 3-[[5-chloro-2-(phenoxyamino)benzoyl]amino]benzoic acid;sulfur monoxide is O=C(O)c1cccc(NC(=O)c2cc(Cl)ccc2NOc2ccccc2)c1.O=S.
What is the InChIKey of 3-[[5-chloro-2-(phenoxyamino)benzoyl]amino]benzoic acid;sulfur monoxide?
The InChIKey is JFCUMWKVSBUIRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClN2O4.OS/c21-14-9-10-18(23-27-16-7-2-1-3-8-16)17(12-14)19(24)22-15-6-4-5-13(11-15)20(25)26;1-2/h1-12,23H,(H,22,24)(H,25,26);.
What are the key properties of 3-[[5-chloro-2-(phenoxyamino)benzoyl]amino]benzoic acid;sulfur monoxide?
3-[[5-chloro-2-(phenoxyamino)benzoyl]amino]benzoic acid;sulfur monoxide has a molecular weight of 430.87 g/mol, XLogP of 4.36, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-chloro-2-(phenoxyamino)benzoyl]amino]benzoic acid;sulfur monoxide is sourced from PubChem (CID 158898396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).