C20H14Cl2N2O4 — CID 23378613
4-[[2-chloro-6-[(4-chlorophenoxy)amino]benzoyl]amino]benzoic acid (PubChem CID 23378613) has the molecular formula C20H14Cl2N2O4 and a molecular weight of 417.25 g/mol. Its IUPAC name is 4-[[2-chloro-6-[(4-chlorophenoxy)amino]benzoyl]amino]benzoic acid.
| Compound Name | 4-[[2-chloro-6-[(4-chlorophenoxy)amino]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 23378613 |
| Molecular Formula | C20H14Cl2N2O4 |
| Molecular Weight | 417.25 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 4-[[2-chloro-6-[(4-chlorophenoxy)amino]benzoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2c(Cl)cccc2NOc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H14Cl2N2O4/c21-13-6-10-15(11-7-13)28-24-17-3-1-2-16(22)18(17)19(25)23-14-8-4-12(5-9-14)20(26)27/h1-11,24H,(H,23,25)(H,26,27) |
| InChIKey | BSDITHNHQHYUTJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.25 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|